About 3-ethoxy-2-pentylphenol;toluene
3-ethoxy-2-pentylphenol;toluene (PubChem CID 174953910) has the molecular formula C20H28O2
and a molecular weight of 300.44 g/mol. Its IUPAC name is 3-ethoxy-2-pentylphenol;toluene.
Molecular Properties
| Compound Name | 3-ethoxy-2-pentylphenol;toluene |
| PubChem CID | 174953910 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-ethoxy-2-pentylphenol;toluene |
| SMILES | CCCCCc1c(O)cccc1OCC.Cc1ccccc1 |
| InChI | InChI=1S/C13H20O2.C7H8/c1-3-5-6-8-11-12(14)9-7-10-13(11)15-4-2;1-7-5-3-2-4-6-7/h7,9-10,14H,3-6,8H2,1-2H3;2-6H,1H3 |
| InChIKey | QEUXZANPLBWYPJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-pentylphenol;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-pentylphenol;toluene?
The IUPAC name of 3-ethoxy-2-pentylphenol;toluene (CID 174953910) is 3-ethoxy-2-pentylphenol;toluene.
What is the SMILES notation for 3-ethoxy-2-pentylphenol;toluene?
The canonical SMILES for 3-ethoxy-2-pentylphenol;toluene is CCCCCc1c(O)cccc1OCC.Cc1ccccc1.
What is the InChIKey of 3-ethoxy-2-pentylphenol;toluene?
The InChIKey is QEUXZANPLBWYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2.C7H8/c1-3-5-6-8-11-12(14)9-7-10-13(11)15-4-2;1-7-5-3-2-4-6-7/h7,9-10,14H,3-6,8H2,1-2H3;2-6H,1H3.
What are the key properties of 3-ethoxy-2-pentylphenol;toluene?
3-ethoxy-2-pentylphenol;toluene has a molecular weight of 300.44 g/mol, XLogP of 5.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-pentylphenol;toluene is sourced from PubChem (CID 174953910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).