About CID 174954011
CID 174954011 (PubChem CID 174954011) has the molecular formula C11H24AlO3Si
and a molecular weight of 259.38 g/mol.
Molecular Properties
| Compound Name | CID 174954011 |
| PubChem CID | 174954011 |
| Molecular Formula | C11H24AlO3Si |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | — |
| SMILES | CCCC[SiH]1CCCCO1.C[Al]OC(C)=O |
| InChI | InChI=1S/C8H18OSi.C2H4O2.CH3.Al/c1-2-3-7-10-8-5-4-6-9-10;1-2(3)4;;/h10H,2-8H2,1H3;1H3,(H,3,4);1H3;/q;;;+1/p-1 |
| InChIKey | RRQNFQWPINDWEO-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174954011 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174954011?
The IUPAC name of CID 174954011 (CID 174954011) is not available.
What is the SMILES notation for CID 174954011?
The canonical SMILES for CID 174954011 is CCCC[SiH]1CCCCO1.C[Al]OC(C)=O.
What is the InChIKey of CID 174954011?
The InChIKey is RRQNFQWPINDWEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18OSi.C2H4O2.CH3.Al/c1-2-3-7-10-8-5-4-6-9-10;1-2(3)4;;/h10H,2-8H2,1H3;1H3,(H,3,4);1H3;/q;;;+1/p-1.
What are the key properties of CID 174954011?
CID 174954011 has a molecular weight of 259.38 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174954011 is sourced from PubChem (CID 174954011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).