About cyclobutanamine;1-dimethoxysilylethanamine
cyclobutanamine;1-dimethoxysilylethanamine (PubChem CID 174954653) has the molecular formula C8H22N2O2Si
and a molecular weight of 206.36 g/mol. Its IUPAC name is cyclobutanamine;1-dimethoxysilylethanamine.
Molecular Properties
| Compound Name | cyclobutanamine;1-dimethoxysilylethanamine |
| PubChem CID | 174954653 |
| Molecular Formula | C8H22N2O2Si |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | cyclobutanamine;1-dimethoxysilylethanamine |
| SMILES | CO[SiH](OC)C(C)N.NC1CCC1 |
| InChI | InChI=1S/C4H13NO2Si.C4H9N/c1-4(5)8(6-2)7-3;5-4-2-1-3-4/h4,8H,5H2,1-3H3;4H,1-3,5H2 |
| InChIKey | SDCZSHUNDPLWRR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclobutanamine;1-dimethoxysilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanamine;1-dimethoxysilylethanamine?
The IUPAC name of cyclobutanamine;1-dimethoxysilylethanamine (CID 174954653) is cyclobutanamine;1-dimethoxysilylethanamine.
What is the SMILES notation for cyclobutanamine;1-dimethoxysilylethanamine?
The canonical SMILES for cyclobutanamine;1-dimethoxysilylethanamine is CO[SiH](OC)C(C)N.NC1CCC1.
What is the InChIKey of cyclobutanamine;1-dimethoxysilylethanamine?
The InChIKey is SDCZSHUNDPLWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13NO2Si.C4H9N/c1-4(5)8(6-2)7-3;5-4-2-1-3-4/h4,8H,5H2,1-3H3;4H,1-3,5H2.
What are the key properties of cyclobutanamine;1-dimethoxysilylethanamine?
cyclobutanamine;1-dimethoxysilylethanamine has a molecular weight of 206.36 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanamine;1-dimethoxysilylethanamine is sourced from PubChem (CID 174954653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).