C19H19NO3S — CID 17495507
N-benzhydryl-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide (PubChem CID 17495507) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-benzhydryl-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide.
| Compound Name | N-benzhydryl-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 17495507 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-benzhydryl-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
| SMILES | O=C(CC1C=CS(=O)(=O)C1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3S/c21-18(13-15-11-12-24(22,23)14-15)20-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,15,19H,13-14H2,(H,20,21) |
| InChIKey | ODDDXNZNXXVPEL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |