C6H8N2O2S3 — CID 174955796
but-3-enoic acid;1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 174955796) has the molecular formula C6H8N2O2S3 and a molecular weight of 236.34 g/mol. Its IUPAC name is but-3-enoic acid;1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | but-3-enoic acid;1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 174955796 |
| Molecular Formula | C6H8N2O2S3 |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | but-3-enoic acid;1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | C=CCC(=O)O.S=c1[nH][nH]c(=S)s1 |
| InChI | InChI=1S/C4H6O2.C2H2N2S3/c1-2-3-4(5)6;5-1-3-4-2(6)7-1/h2H,1,3H2,(H,5,6);(H,3,5)(H,4,6) |
| InChIKey | VGEQIENFLUWQAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|