H5O7P3S3Zn — CID 174957487
bis(dihydroxyphosphinothioyloxy)-hydroxy-sulfanylidene-λ5-phosphane;zinc (PubChem CID 174957487) has the molecular formula H5O7P3S3Zn and a molecular weight of 371.55 g/mol. Its IUPAC name is bis(dihydroxyphosphinothioyloxy)-hydroxy-sulfanylidene-λ5-phosphane;zinc.
| Compound Name | bis(dihydroxyphosphinothioyloxy)-hydroxy-sulfanylidene-λ5-phosphane;zinc |
|---|---|
| PubChem CID | 174957487 |
| Molecular Formula | H5O7P3S3Zn |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 369.77 |
| IUPAC Name | bis(dihydroxyphosphinothioyloxy)-hydroxy-sulfanylidene-λ5-phosphane;zinc |
| SMILES | OP(O)(=S)OP(O)(=S)OP(O)(O)=S.[Zn] |
| InChI | InChI=1S/H5O7P3S3.Zn/c1-8(2,11)6-10(5,13)7-9(3,4)12;/h(H,5,13)(H2,1,2,11)(H2,3,4,12); |
| InChIKey | KMJUEKNRLXWXQO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|