C7H18O6P2S2 — CID 175277312
dihydroxyphosphinothioyloxy-[2-(2,2-dimethylpropoxy)ethoxy]-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 175277312) has the molecular formula C7H18O6P2S2 and a molecular weight of 324.30 g/mol. Its IUPAC name is dihydroxyphosphinothioyloxy-[2-(2,2-dimethylpropoxy)ethoxy]-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxyphosphinothioyloxy-[2-(2,2-dimethylpropoxy)ethoxy]-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 175277312 |
| Molecular Formula | C7H18O6P2S2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | dihydroxyphosphinothioyloxy-[2-(2,2-dimethylpropoxy)ethoxy]-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)(C)COCCOP(O)(=S)OP(O)(O)=S |
| InChI | InChI=1S/C7H18O6P2S2/c1-7(2,3)6-11-4-5-12-15(10,17)13-14(8,9)16/h4-6H2,1-3H3,(H,10,17)(H2,8,9,16) |
| InChIKey | POECYIAXHHMTJN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|