ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid

C10H19ClN2O4 — CID 174958669

IUPACethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid
SMILESCCOC(=O)Cl.NNC1CCC(C(=O)O)CC1
InChIInChI=1S/C7H14N2O2.C3H5ClO2/c8-9-6-3-1-5(2-4-6)7(10)11;1-2-6-3(4)5/h5-6,9H,1-4,8H2,(H,10,11);2H2,1H3
InChIKeyXSTPURNTEAQQHW-UHFFFAOYSA-N
MW266.72 g/mol
LogP1.47
Rot. Bonds3

About ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid

ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid (PubChem CID 174958669) has the molecular formula C10H19ClN2O4 and a molecular weight of 266.72 g/mol. Its IUPAC name is ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid.

Molecular Properties

Compound Nameethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid
PubChem CID174958669
Molecular FormulaC10H19ClN2O4
Molecular Weight266.72 g/mol
Exact Mass266.10
IUPAC Nameethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid
SMILESCCOC(=O)Cl.NNC1CCC(C(=O)O)CC1
InChIInChI=1S/C7H14N2O2.C3H5ClO2/c8-9-6-3-1-5(2-4-6)7(10)11;1-2-6-3(4)5/h5-6,9H,1-4,8H2,(H,10,11);2H2,1H3
InChIKeyXSTPURNTEAQQHW-UHFFFAOYSA-N
XLogP1.47
TPSA101.65 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.72
LogP ≤ 51.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid?
The IUPAC name of ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid (CID 174958669) is ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid.
What is the SMILES notation for ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid?
The canonical SMILES for ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid is CCOC(=O)Cl.NNC1CCC(C(=O)O)CC1.
What is the InChIKey of ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid?
The InChIKey is XSTPURNTEAQQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2.C3H5ClO2/c8-9-6-3-1-5(2-4-6)7(10)11;1-2-6-3(4)5/h5-6,9H,1-4,8H2,(H,10,11);2H2,1H3.
What are the key properties of ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid?
ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid has a molecular weight of 266.72 g/mol, XLogP of 1.47, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 174958669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).