C10H19ClN2O4 — CID 174958669
ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid (PubChem CID 174958669) has the molecular formula C10H19ClN2O4 and a molecular weight of 266.72 g/mol. Its IUPAC name is ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid.
| Compound Name | ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174958669 |
| Molecular Formula | C10H19ClN2O4 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | ethyl carbonochloridate;4-hydrazinylcyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)Cl.NNC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C7H14N2O2.C3H5ClO2/c8-9-6-3-1-5(2-4-6)7(10)11;1-2-6-3(4)5/h5-6,9H,1-4,8H2,(H,10,11);2H2,1H3 |
| InChIKey | XSTPURNTEAQQHW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|