C12H19AlO — CID 174960273
oxoalumane;1,2,4-tri(ethylidene)cyclohexane (PubChem CID 174960273) has the molecular formula C12H19AlO and a molecular weight of 206.27 g/mol. Its IUPAC name is oxoalumane;1,2,4-tri(ethylidene)cyclohexane.
| Compound Name | oxoalumane;1,2,4-tri(ethylidene)cyclohexane |
|---|---|
| PubChem CID | 174960273 |
| Molecular Formula | C12H19AlO |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | oxoalumane;1,2,4-tri(ethylidene)cyclohexane |
| SMILES | CC=C1CCC(=CC)C(=CC)C1.O=[AlH] |
| InChI | InChI=1S/C12H18.Al.O.H/c1-4-10-7-8-11(5-2)12(6-3)9-10;;;/h4-6H,7-9H2,1-3H3;;; |
| InChIKey | LAIDINPJTCELAV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|