About sodium;hydride;propyl oxiran-2-ylmethanesulfonate
sodium;hydride;propyl oxiran-2-ylmethanesulfonate (PubChem CID 174960442) has the molecular formula C6H13NaO4S
and a molecular weight of 204.22 g/mol. Its IUPAC name is sodium;hydride;propyl oxiran-2-ylmethanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;propyl oxiran-2-ylmethanesulfonate |
| PubChem CID | 174960442 |
| Molecular Formula | C6H13NaO4S |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | sodium;hydride;propyl oxiran-2-ylmethanesulfonate |
| SMILES | CCCOS(=O)(=O)CC1CO1.[H-].[Na+] |
| InChI | InChI=1S/C6H12O4S.Na.H/c1-2-3-10-11(7,8)5-6-4-9-6;;/h6H,2-5H2,1H3;;/q;+1;-1 |
| InChIKey | XLTLHKABTBVKEQ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;propyl oxiran-2-ylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;propyl oxiran-2-ylmethanesulfonate?
The IUPAC name of sodium;hydride;propyl oxiran-2-ylmethanesulfonate (CID 174960442) is sodium;hydride;propyl oxiran-2-ylmethanesulfonate.
What is the SMILES notation for sodium;hydride;propyl oxiran-2-ylmethanesulfonate?
The canonical SMILES for sodium;hydride;propyl oxiran-2-ylmethanesulfonate is CCCOS(=O)(=O)CC1CO1.[H-].[Na+].
What is the InChIKey of sodium;hydride;propyl oxiran-2-ylmethanesulfonate?
The InChIKey is XLTLHKABTBVKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4S.Na.H/c1-2-3-10-11(7,8)5-6-4-9-6;;/h6H,2-5H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;propyl oxiran-2-ylmethanesulfonate?
sodium;hydride;propyl oxiran-2-ylmethanesulfonate has a molecular weight of 204.22 g/mol, XLogP of -2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;propyl oxiran-2-ylmethanesulfonate is sourced from PubChem (CID 174960442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).