C22H44O6S2 — CID 98082915
(2R,5R)-2,5-bis(octylsulfonylmethyl)-1,4-dioxane (PubChem CID 98082915) has the molecular formula C22H44O6S2 and a molecular weight of 468.72 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(octylsulfonylmethyl)-1,4-dioxane.
| Compound Name | (2R,5R)-2,5-bis(octylsulfonylmethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 98082915 |
| Molecular Formula | C22H44O6S2 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (2R,5R)-2,5-bis(octylsulfonylmethyl)-1,4-dioxane |
| SMILES | CCCCCCCCS(=O)(=O)C[C@H]1CO[C@@H](CS(=O)(=O)CCCCCCCC)CO1 |
| InChI | InChI=1S/C22H44O6S2/c1-3-5-7-9-11-13-15-29(23,24)19-21-17-28-22(18-27-21)20-30(25,26)16-14-12-10-8-6-4-2/h21-22H,3-20H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | KPUDBQHPYHKHCV-FGZHOGPDSA-N |
| XLogP | 4.32 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|