About 4-methylpyrimidin-2-amine;pyridin-2-amine
4-methylpyrimidin-2-amine;pyridin-2-amine (PubChem CID 174965113) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-methylpyrimidin-2-amine;pyridin-2-amine.
Molecular Properties
| Compound Name | 4-methylpyrimidin-2-amine;pyridin-2-amine |
| PubChem CID | 174965113 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-methylpyrimidin-2-amine;pyridin-2-amine |
| SMILES | Cc1ccnc(N)n1.Nc1ccccn1 |
| InChI | InChI=1S/C5H7N3.C5H6N2/c1-4-2-3-7-5(6)8-4;6-5-3-1-2-4-7-5/h2-3H,1H3,(H2,6,7,8);1-4H,(H2,6,7) |
| InChIKey | AVGBHVWGCQTUFD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methylpyrimidin-2-amine;pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyrimidin-2-amine;pyridin-2-amine?
The IUPAC name of 4-methylpyrimidin-2-amine;pyridin-2-amine (CID 174965113) is 4-methylpyrimidin-2-amine;pyridin-2-amine.
What is the SMILES notation for 4-methylpyrimidin-2-amine;pyridin-2-amine?
The canonical SMILES for 4-methylpyrimidin-2-amine;pyridin-2-amine is Cc1ccnc(N)n1.Nc1ccccn1.
What is the InChIKey of 4-methylpyrimidin-2-amine;pyridin-2-amine?
The InChIKey is AVGBHVWGCQTUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3.C5H6N2/c1-4-2-3-7-5(6)8-4;6-5-3-1-2-4-7-5/h2-3H,1H3,(H2,6,7,8);1-4H,(H2,6,7).
What are the key properties of 4-methylpyrimidin-2-amine;pyridin-2-amine?
4-methylpyrimidin-2-amine;pyridin-2-amine has a molecular weight of 203.25 g/mol, XLogP of 1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyrimidin-2-amine;pyridin-2-amine is sourced from PubChem (CID 174965113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).