About pyrene;pyridin-2-amine
pyrene;pyridin-2-amine (PubChem CID 161074753) has the molecular formula C21H16N2
and a molecular weight of 296.37 g/mol. Its IUPAC name is pyrene;pyridin-2-amine.
Molecular Properties
| Compound Name | pyrene;pyridin-2-amine |
| PubChem CID | 161074753 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | pyrene;pyridin-2-amine |
| SMILES | Nc1ccccn1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C5H6N2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;6-5-3-1-2-4-7-5/h1-10H;1-4H,(H2,6,7) |
| InChIKey | UFCRZFLOWMPSKS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;pyridin-2-amine?
The IUPAC name of pyrene;pyridin-2-amine (CID 161074753) is pyrene;pyridin-2-amine.
What is the SMILES notation for pyrene;pyridin-2-amine?
The canonical SMILES for pyrene;pyridin-2-amine is Nc1ccccn1.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of pyrene;pyridin-2-amine?
The InChIKey is UFCRZFLOWMPSKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C5H6N2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;6-5-3-1-2-4-7-5/h1-10H;1-4H,(H2,6,7).
What are the key properties of pyrene;pyridin-2-amine?
pyrene;pyridin-2-amine has a molecular weight of 296.37 g/mol, XLogP of 5.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;pyridin-2-amine is sourced from PubChem (CID 161074753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).