About decyl-tri(propan-2-yl)silane;hydrofluoride
decyl-tri(propan-2-yl)silane;hydrofluoride (PubChem CID 174965552) has the molecular formula C19H43FSi
and a molecular weight of 318.64 g/mol. Its IUPAC name is decyl-tri(propan-2-yl)silane;hydrofluoride.
Molecular Properties
| Compound Name | decyl-tri(propan-2-yl)silane;hydrofluoride |
| PubChem CID | 174965552 |
| Molecular Formula | C19H43FSi |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 318.31 |
| IUPAC Name | decyl-tri(propan-2-yl)silane;hydrofluoride |
| SMILES | CCCCCCCCCC[Si](C(C)C)(C(C)C)C(C)C.F |
| InChI | InChI=1S/C19H42Si.FH/c1-8-9-10-11-12-13-14-15-16-20(17(2)3,18(4)5)19(6)7;/h17-19H,8-16H2,1-7H3;1H |
| InChIKey | YWFCFXDTCWKYBW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decyl-tri(propan-2-yl)silane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl-tri(propan-2-yl)silane;hydrofluoride?
The IUPAC name of decyl-tri(propan-2-yl)silane;hydrofluoride (CID 174965552) is decyl-tri(propan-2-yl)silane;hydrofluoride.
What is the SMILES notation for decyl-tri(propan-2-yl)silane;hydrofluoride?
The canonical SMILES for decyl-tri(propan-2-yl)silane;hydrofluoride is CCCCCCCCCC[Si](C(C)C)(C(C)C)C(C)C.F.
What is the InChIKey of decyl-tri(propan-2-yl)silane;hydrofluoride?
The InChIKey is YWFCFXDTCWKYBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42Si.FH/c1-8-9-10-11-12-13-14-15-16-20(17(2)3,18(4)5)19(6)7;/h17-19H,8-16H2,1-7H3;1H.
What are the key properties of decyl-tri(propan-2-yl)silane;hydrofluoride?
decyl-tri(propan-2-yl)silane;hydrofluoride has a molecular weight of 318.64 g/mol, XLogP of 7.96, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for decyl-tri(propan-2-yl)silane;hydrofluoride is sourced from PubChem (CID 174965552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).