About 2-methylheptane;trichloro(decyl)silane;hydrofluoride
2-methylheptane;trichloro(decyl)silane;hydrofluoride (PubChem CID 174930865) has the molecular formula C18H40Cl3FSi
and a molecular weight of 409.96 g/mol. Its IUPAC name is 2-methylheptane;trichloro(decyl)silane;hydrofluoride.
Molecular Properties
| Compound Name | 2-methylheptane;trichloro(decyl)silane;hydrofluoride |
| PubChem CID | 174930865 |
| Molecular Formula | C18H40Cl3FSi |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-methylheptane;trichloro(decyl)silane;hydrofluoride |
| SMILES | CCCCCC(C)C.CCCCCCCCCC[Si](Cl)(Cl)Cl.F |
| InChI | InChI=1S/C10H21Cl3Si.C8H18.FH/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;1-4-5-6-7-8(2)3;/h2-10H2,1H3;8H,4-7H2,1-3H3;1H |
| InChIKey | CQBQQFHRYBENKC-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptane;trichloro(decyl)silane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptane;trichloro(decyl)silane;hydrofluoride?
The IUPAC name of 2-methylheptane;trichloro(decyl)silane;hydrofluoride (CID 174930865) is 2-methylheptane;trichloro(decyl)silane;hydrofluoride.
What is the SMILES notation for 2-methylheptane;trichloro(decyl)silane;hydrofluoride?
The canonical SMILES for 2-methylheptane;trichloro(decyl)silane;hydrofluoride is CCCCCC(C)C.CCCCCCCCCC[Si](Cl)(Cl)Cl.F.
What is the InChIKey of 2-methylheptane;trichloro(decyl)silane;hydrofluoride?
The InChIKey is CQBQQFHRYBENKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21Cl3Si.C8H18.FH/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;1-4-5-6-7-8(2)3;/h2-10H2,1H3;8H,4-7H2,1-3H3;1H.
What are the key properties of 2-methylheptane;trichloro(decyl)silane;hydrofluoride?
2-methylheptane;trichloro(decyl)silane;hydrofluoride has a molecular weight of 409.96 g/mol, XLogP of 9.16, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptane;trichloro(decyl)silane;hydrofluoride is sourced from PubChem (CID 174930865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).