About chlorosilane;2-methylundecane
chlorosilane;2-methylundecane (PubChem CID 173228312) has the molecular formula C12H29ClSi
and a molecular weight of 236.90 g/mol. Its IUPAC name is chlorosilane;2-methylundecane.
Molecular Properties
| Compound Name | chlorosilane;2-methylundecane |
| PubChem CID | 173228312 |
| Molecular Formula | C12H29ClSi |
| Molecular Weight | 236.90 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | chlorosilane;2-methylundecane |
| SMILES | CCCCCCCCCC(C)C.[SiH3]Cl |
| InChI | InChI=1S/C12H26.ClH3Si/c1-4-5-6-7-8-9-10-11-12(2)3;1-2/h12H,4-11H2,1-3H3;2H3 |
| InChIKey | KRTFEXUASLKAJN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;2-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;2-methylundecane?
The IUPAC name of chlorosilane;2-methylundecane (CID 173228312) is chlorosilane;2-methylundecane.
What is the SMILES notation for chlorosilane;2-methylundecane?
The canonical SMILES for chlorosilane;2-methylundecane is CCCCCCCCCC(C)C.[SiH3]Cl.
What is the InChIKey of chlorosilane;2-methylundecane?
The InChIKey is KRTFEXUASLKAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.ClH3Si/c1-4-5-6-7-8-9-10-11-12(2)3;1-2/h12H,4-11H2,1-3H3;2H3.
What are the key properties of chlorosilane;2-methylundecane?
chlorosilane;2-methylundecane has a molecular weight of 236.90 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;2-methylundecane is sourced from PubChem (CID 173228312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).