About dichloro(dimethyl)silane;2-methylheptane
dichloro(dimethyl)silane;2-methylheptane (PubChem CID 87807519) has the molecular formula C10H24Cl2Si
and a molecular weight of 243.29 g/mol. Its IUPAC name is dichloro(dimethyl)silane;2-methylheptane.
Molecular Properties
| Compound Name | dichloro(dimethyl)silane;2-methylheptane |
| PubChem CID | 87807519 |
| Molecular Formula | C10H24Cl2Si |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | dichloro(dimethyl)silane;2-methylheptane |
| SMILES | CCCCCC(C)C.C[Si](C)(Cl)Cl |
| InChI | InChI=1S/C8H18.C2H6Cl2Si/c1-4-5-6-7-8(2)3;1-5(2,3)4/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | PZNPMCPJVAEAQW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethyl)silane;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)silane;2-methylheptane?
The IUPAC name of dichloro(dimethyl)silane;2-methylheptane (CID 87807519) is dichloro(dimethyl)silane;2-methylheptane.
What is the SMILES notation for dichloro(dimethyl)silane;2-methylheptane?
The canonical SMILES for dichloro(dimethyl)silane;2-methylheptane is CCCCCC(C)C.C[Si](C)(Cl)Cl.
What is the InChIKey of dichloro(dimethyl)silane;2-methylheptane?
The InChIKey is PZNPMCPJVAEAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C2H6Cl2Si/c1-4-5-6-7-8(2)3;1-5(2,3)4/h8H,4-7H2,1-3H3;1-2H3.
What are the key properties of dichloro(dimethyl)silane;2-methylheptane?
dichloro(dimethyl)silane;2-methylheptane has a molecular weight of 243.29 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)silane;2-methylheptane is sourced from PubChem (CID 87807519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).