About anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine
anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine (PubChem CID 174966911) has the molecular formula C18H24BrNO2
and a molecular weight of 366.30 g/mol. Its IUPAC name is anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine.
Molecular Properties
| Compound Name | anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine |
| PubChem CID | 174966911 |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine |
| SMILES | COc1ccccc1.COc1nc(C(C)(C)C)ccc1CBr |
| InChI | InChI=1S/C11H16BrNO.C7H8O/c1-11(2,3)9-6-5-8(7-12)10(13-9)14-4;1-8-7-5-3-2-4-6-7/h5-6H,7H2,1-4H3;2-6H,1H3 |
| InChIKey | FXESZTXESICQLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine?
The IUPAC name of anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine (CID 174966911) is anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine.
What is the SMILES notation for anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine?
The canonical SMILES for anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine is COc1ccccc1.COc1nc(C(C)(C)C)ccc1CBr.
What is the InChIKey of anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine?
The InChIKey is FXESZTXESICQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrNO.C7H8O/c1-11(2,3)9-6-5-8(7-12)10(13-9)14-4;1-8-7-5-3-2-4-6-7/h5-6H,7H2,1-4H3;2-6H,1H3.
What are the key properties of anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine?
anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine has a molecular weight of 366.30 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;3-(bromomethyl)-6-tert-butyl-2-methoxypyridine is sourced from PubChem (CID 174966911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).