About 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine
2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine (PubChem CID 174967264) has the molecular formula C12H13ClN2O3
and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine.
Molecular Properties
| Compound Name | 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine |
| PubChem CID | 174967264 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine |
| SMILES | CN.COc1cc2nc(Cl)ccc2cc1C(=O)O |
| InChI | InChI=1S/C11H8ClNO3.CH5N/c1-16-9-5-8-6(2-3-10(12)13-8)4-7(9)11(14)15;1-2/h2-5H,1H3,(H,14,15);2H2,1H3 |
| InChIKey | WIPSKADNUUMASZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine?
The IUPAC name of 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine (CID 174967264) is 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine.
What is the SMILES notation for 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine?
The canonical SMILES for 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine is CN.COc1cc2nc(Cl)ccc2cc1C(=O)O.
What is the InChIKey of 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine?
The InChIKey is WIPSKADNUUMASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO3.CH5N/c1-16-9-5-8-6(2-3-10(12)13-8)4-7(9)11(14)15;1-2/h2-5H,1H3,(H,14,15);2H2,1H3.
What are the key properties of 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine?
2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine has a molecular weight of 268.70 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-methoxyquinoline-6-carboxylic acid;methanamine is sourced from PubChem (CID 174967264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).