C19H17FN6O2S — CID 174967436
[2-[[2-(4-fluoroanilino)-8-methyl-7H-purin-6-yl]amino]phenyl]methanesulfinic acid (PubChem CID 174967436) has the molecular formula C19H17FN6O2S and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-8-methyl-7H-purin-6-yl]amino]phenyl]methanesulfinic acid.
| Compound Name | [2-[[2-(4-fluoroanilino)-8-methyl-7H-purin-6-yl]amino]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174967436 |
| Molecular Formula | C19H17FN6O2S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-8-methyl-7H-purin-6-yl]amino]phenyl]methanesulfinic acid |
| SMILES | Cc1nc2nc(Nc3ccc(F)cc3)nc(Nc3ccccc3CS(=O)O)c2[nH]1 |
| InChI | InChI=1S/C19H17FN6O2S/c1-11-21-16-17(22-11)25-19(23-14-8-6-13(20)7-9-14)26-18(16)24-15-5-3-2-4-12(15)10-29(27)28/h2-9H,10H2,1H3,(H,27,28)(H3,21,22,23,24,25,26) |
| InChIKey | AFFQQFLRRATEBL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|