About magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid
magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid (PubChem CID 174967520) has the molecular formula C22H44MgO4
and a molecular weight of 396.90 g/mol. Its IUPAC name is magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid.
Molecular Properties
| Compound Name | magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid |
| PubChem CID | 174967520 |
| Molecular Formula | C22H44MgO4 |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid |
| SMILES | CCCCCCCCCCCCC(CCCCC)CC(C(=O)O)C(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C22H42O4.Mg.2H/c1-3-5-7-8-9-10-11-12-13-15-17-19(16-14-6-4-2)18-20(21(23)24)22(25)26;;;/h19-20H,3-18H2,1-2H3,(H,23,24)(H,25,26);;;/q;+2;2*-1 |
| InChIKey | HQQVVUUORPFFAZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid?
The IUPAC name of magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid (CID 174967520) is magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid.
What is the SMILES notation for magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid?
The canonical SMILES for magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid is CCCCCCCCCCCCC(CCCCC)CC(C(=O)O)C(=O)O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid?
The InChIKey is HQQVVUUORPFFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4.Mg.2H/c1-3-5-7-8-9-10-11-12-13-15-17-19(16-14-6-4-2)18-20(21(23)24)22(25)26;;;/h19-20H,3-18H2,1-2H3,(H,23,24)(H,25,26);;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid?
magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid has a molecular weight of 396.90 g/mol, XLogP of 6.51, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;2-(2-pentyltetradecyl)propanedioic acid is sourced from PubChem (CID 174967520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).