About calcium;2-(2-butyldodecyl)propanedioic acid;hydride
calcium;2-(2-butyldodecyl)propanedioic acid;hydride (PubChem CID 174967651) has the molecular formula C19H38CaO4
and a molecular weight of 370.59 g/mol. Its IUPAC name is calcium;2-(2-butyldodecyl)propanedioic acid;hydride.
Molecular Properties
| Compound Name | calcium;2-(2-butyldodecyl)propanedioic acid;hydride |
| PubChem CID | 174967651 |
| Molecular Formula | C19H38CaO4 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | calcium;2-(2-butyldodecyl)propanedioic acid;hydride |
| SMILES | CCCCCCCCCCC(CCCC)CC(C(=O)O)C(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C19H36O4.Ca.2H/c1-3-5-7-8-9-10-11-12-14-16(13-6-4-2)15-17(18(20)21)19(22)23;;;/h16-17H,3-15H2,1-2H3,(H,20,21)(H,22,23);;;/q;+2;2*-1 |
| InChIKey | MDQHUHYYOATVQG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze calcium;2-(2-butyldodecyl)propanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-(2-butyldodecyl)propanedioic acid;hydride?
The IUPAC name of calcium;2-(2-butyldodecyl)propanedioic acid;hydride (CID 174967651) is calcium;2-(2-butyldodecyl)propanedioic acid;hydride.
What is the SMILES notation for calcium;2-(2-butyldodecyl)propanedioic acid;hydride?
The canonical SMILES for calcium;2-(2-butyldodecyl)propanedioic acid;hydride is CCCCCCCCCCC(CCCC)CC(C(=O)O)C(=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;2-(2-butyldodecyl)propanedioic acid;hydride?
The InChIKey is MDQHUHYYOATVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4.Ca.2H/c1-3-5-7-8-9-10-11-12-14-16(13-6-4-2)15-17(18(20)21)19(22)23;;;/h16-17H,3-15H2,1-2H3,(H,20,21)(H,22,23);;;/q;+2;2*-1.
What are the key properties of calcium;2-(2-butyldodecyl)propanedioic acid;hydride?
calcium;2-(2-butyldodecyl)propanedioic acid;hydride has a molecular weight of 370.59 g/mol, XLogP of 5.34, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-(2-butyldodecyl)propanedioic acid;hydride is sourced from PubChem (CID 174967651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).