C18H34LaNO3Ti — CID 174971936
azanylidynetitanium;(Z,12R)-12-hydroxyoctadec-9-enoic acid;lanthanum (PubChem CID 174971936) has the molecular formula C18H34LaNO3Ti and a molecular weight of 499.25 g/mol. Its IUPAC name is azanylidynetitanium;(Z,12R)-12-hydroxyoctadec-9-enoic acid;lanthanum.
| Compound Name | azanylidynetitanium;(Z,12R)-12-hydroxyoctadec-9-enoic acid;lanthanum |
|---|---|
| PubChem CID | 174971936 |
| Molecular Formula | C18H34LaNO3Ti |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | azanylidynetitanium;(Z,12R)-12-hydroxyoctadec-9-enoic acid;lanthanum |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O.N#[Ti].[La] |
| InChI | InChI=1S/C18H34O3.La.N.Ti/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;;;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);;;/b12-9-;;;/t17-;;;/m1.../s1 |
| InChIKey | UJUSQJJGIBKSJW-IYCCMTEQSA-N |
| XLogP | 5.09 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|