C15H13N3O — CID 174976406
(4,5-diphenyltriazol-1-yl)methanol (PubChem CID 174976406) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is (4,5-diphenyltriazol-1-yl)methanol.
| Compound Name | (4,5-diphenyltriazol-1-yl)methanol |
|---|---|
| PubChem CID | 174976406 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (4,5-diphenyltriazol-1-yl)methanol |
| SMILES | OCn1nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H13N3O/c19-11-18-15(13-9-5-2-6-10-13)14(16-17-18)12-7-3-1-4-8-12/h1-10,19H,11H2 |
| InChIKey | CFDJEGNDTVFJMQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |