C26H39N3O4 — CID 174977467
(6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;2-(2-ethoxyethoxy)ethanol (PubChem CID 174977467) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;2-(2-ethoxyethoxy)ethanol.
| Compound Name | (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;2-(2-ethoxyethoxy)ethanol |
|---|---|
| PubChem CID | 174977467 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;2-(2-ethoxyethoxy)ethanol |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1.CCOCCOCCO |
| InChI | InChI=1S/C20H25N3O.C6H14O3/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14;1-2-8-5-6-9-4-3-7/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3;7H,2-6H2,1H3/t14-,18-;/m1./s1 |
| InChIKey | RSBYCOITEFJHGH-KEZWHQCISA-N |
| XLogP | 2.94 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|