C15H30N2O — CID 174980443
1-heptan-4-yl-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 174980443) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-heptan-4-yl-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-heptan-4-yl-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 174980443 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-heptan-4-yl-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CCCC(CCC)N1CCCC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C15H30N2O/c1-5-8-14(9-6-2)17-11-7-10-13(12-17)15(18)16(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | CIWNJMYMORPWRE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |