C24H23NO4 — CID 174980675
[(2S)-1-butoxy-1-oxo-3-pyren-1-ylpropan-2-yl]carbamic acid (PubChem CID 174980675) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(2S)-1-butoxy-1-oxo-3-pyren-1-ylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-butoxy-1-oxo-3-pyren-1-ylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174980675 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [(2S)-1-butoxy-1-oxo-3-pyren-1-ylpropan-2-yl]carbamic acid |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc2ccc3cccc4ccc1c2c34)NC(=O)O |
| InChI | InChI=1S/C24H23NO4/c1-2-3-13-29-23(26)20(25-24(27)28)14-18-10-9-17-8-7-15-5-4-6-16-11-12-19(18)22(17)21(15)16/h4-12,20,25H,2-3,13-14H2,1H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | HICTUTHNDHPBQJ-FQEVSTJZSA-N |
| XLogP | 5.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|