C21H22N4O4 — CID 17498127
N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide (PubChem CID 17498127) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 17498127 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
| SMILES | Cn1nc(CC(=O)NC2CCN(C(=O)c3ccco3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O4/c1-24-20(27)16-6-3-2-5-15(16)17(23-24)13-19(26)22-14-8-10-25(11-9-14)21(28)18-7-4-12-29-18/h2-7,12,14H,8-11,13H2,1H3,(H,22,26) |
| InChIKey | GNAMGNLCZPTRTG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |