C20H24N4O3 — CID 49352294
N-cyclopropyl-1-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 49352294) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-cyclopropyl-1-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49352294 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-cyclopropyl-1-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | Cn1nc(CC(=O)N2CCCC(C(=O)NC3CC3)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H24N4O3/c1-23-20(27)16-7-3-2-6-15(16)17(22-23)11-18(25)24-10-4-5-13(12-24)19(26)21-14-8-9-14/h2-3,6-7,13-14H,4-5,8-12H2,1H3,(H,21,26) |
| InChIKey | FLIMALQWAZJOSD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |