C22H28N4O3 — CID 55379468
2-methyl-4-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]phthalazin-1-one (PubChem CID 55379468) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-methyl-4-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 55379468 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-methyl-4-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]phthalazin-1-one |
| SMILES | Cn1nc(CC(=O)N2CCC(C(=O)N3CCCCC3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H28N4O3/c1-24-22(29)18-8-4-3-7-17(18)19(23-24)15-20(27)25-13-9-16(10-14-25)21(28)26-11-5-2-6-12-26/h3-4,7-8,16H,2,5-6,9-15H2,1H3 |
| InChIKey | PFHZJLDMEIBJEX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |