About azane;1H-indole-7-carboxamide
azane;1H-indole-7-carboxamide (PubChem CID 174982702) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is azane;1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | azane;1H-indole-7-carboxamide |
| PubChem CID | 174982702 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | azane;1H-indole-7-carboxamide |
| SMILES | N.NC(=O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C9H8N2O.H3N/c10-9(12)7-3-1-2-6-4-5-11-8(6)7;/h1-5,11H,(H2,10,12);1H3 |
| InChIKey | BPMFBPOJYQWPQX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1H-indole-7-carboxamide?
The IUPAC name of azane;1H-indole-7-carboxamide (CID 174982702) is azane;1H-indole-7-carboxamide.
What is the SMILES notation for azane;1H-indole-7-carboxamide?
The canonical SMILES for azane;1H-indole-7-carboxamide is N.NC(=O)c1cccc2cc[nH]c12.
What is the InChIKey of azane;1H-indole-7-carboxamide?
The InChIKey is BPMFBPOJYQWPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.H3N/c10-9(12)7-3-1-2-6-4-5-11-8(6)7;/h1-5,11H,(H2,10,12);1H3.
What are the key properties of azane;1H-indole-7-carboxamide?
azane;1H-indole-7-carboxamide has a molecular weight of 177.21 g/mol, XLogP of 1.43, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1H-indole-7-carboxamide is sourced from PubChem (CID 174982702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).