About (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate
(2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate (PubChem CID 174983557) has the molecular formula C16H11NO5
and a molecular weight of 297.27 g/mol. Its IUPAC name is (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate.
Molecular Properties
| Compound Name | (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate |
| PubChem CID | 174983557 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate |
| SMILES | O=C=C(OC(=O)Cc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H11NO5/c18-11-15(12-6-2-1-3-7-12)22-16(19)10-13-8-4-5-9-14(13)17(20)21/h1-9H,10H2 |
| InChIKey | GOVBOGRVRGDRPA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate?
The IUPAC name of (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate (CID 174983557) is (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate.
What is the SMILES notation for (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate?
The canonical SMILES for (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate is O=C=C(OC(=O)Cc1ccccc1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate?
The InChIKey is GOVBOGRVRGDRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO5/c18-11-15(12-6-2-1-3-7-12)22-16(19)10-13-8-4-5-9-14(13)17(20)21/h1-9H,10H2.
What are the key properties of (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate?
(2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate has a molecular weight of 297.27 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-phenylethenyl) 2-(2-nitrophenyl)acetate is sourced from PubChem (CID 174983557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).