About 2-(2-nitrophenyl)-N,1-diphenylethanimine
2-(2-nitrophenyl)-N,1-diphenylethanimine (PubChem CID 141478999) has the molecular formula C20H16N2O2
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N,1-diphenylethanimine.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-N,1-diphenylethanimine |
| PubChem CID | 141478999 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-(2-nitrophenyl)-N,1-diphenylethanimine |
| SMILES | O=[N+]([O-])c1ccccc1C/C(=N/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2/c23-22(24)20-14-8-7-11-17(20)15-19(16-9-3-1-4-10-16)21-18-12-5-2-6-13-18/h1-14H,15H2/b21-19- |
| InChIKey | MYVPNMKWTOBZPI-VZCXRCSSSA-N |
| XLogP | 4.96 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-N,1-diphenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-N,1-diphenylethanimine?
The IUPAC name of 2-(2-nitrophenyl)-N,1-diphenylethanimine (CID 141478999) is 2-(2-nitrophenyl)-N,1-diphenylethanimine.
What is the SMILES notation for 2-(2-nitrophenyl)-N,1-diphenylethanimine?
The canonical SMILES for 2-(2-nitrophenyl)-N,1-diphenylethanimine is O=[N+]([O-])c1ccccc1C/C(=N/c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2-nitrophenyl)-N,1-diphenylethanimine?
The InChIKey is MYVPNMKWTOBZPI-VZCXRCSSSA-N. The full InChI is InChI=1S/C20H16N2O2/c23-22(24)20-14-8-7-11-17(20)15-19(16-9-3-1-4-10-16)21-18-12-5-2-6-13-18/h1-14H,15H2/b21-19-.
What are the key properties of 2-(2-nitrophenyl)-N,1-diphenylethanimine?
2-(2-nitrophenyl)-N,1-diphenylethanimine has a molecular weight of 316.36 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-N,1-diphenylethanimine is sourced from PubChem (CID 141478999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).