2-nitro-N-phenylbenzenecarboximidoyl chloride

C13H9ClN2O2 — CID 13213133

IUPAC2-nitro-N-phenylbenzenecarboximidoyl chloride
SMILESO=[N+]([O-])c1ccccc1/C(Cl)=N/c1ccccc1
InChIInChI=1S/C13H9ClN2O2/c14-13(15-10-6-2-1-3-7-10)11-8-4-5-9-12(11)16(17)18/h1-9H/b15-13-
InChIKeyCYDYEUKLYFMUGJ-SQFISAMPSA-N
MW260.68 g/mol
LogP3.91
Rot. Bonds3

About 2-nitro-N-phenylbenzenecarboximidoyl chloride

2-nitro-N-phenylbenzenecarboximidoyl chloride (PubChem CID 13213133) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is 2-nitro-N-phenylbenzenecarboximidoyl chloride.

Molecular Properties

Compound Name2-nitro-N-phenylbenzenecarboximidoyl chloride
PubChem CID13213133
Molecular FormulaC13H9ClN2O2
Molecular Weight260.68 g/mol
Exact Mass260.04
IUPAC Name2-nitro-N-phenylbenzenecarboximidoyl chloride
SMILESO=[N+]([O-])c1ccccc1/C(Cl)=N/c1ccccc1
InChIInChI=1S/C13H9ClN2O2/c14-13(15-10-6-2-1-3-7-10)11-8-4-5-9-12(11)16(17)18/h1-9H/b15-13-
InChIKeyCYDYEUKLYFMUGJ-SQFISAMPSA-N
XLogP3.91
TPSA55.50 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.68
LogP ≤ 53.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-nitro-N-phenylbenzenecarboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-nitro-N-phenylbenzenecarboximidoyl chloride?
The IUPAC name of 2-nitro-N-phenylbenzenecarboximidoyl chloride (CID 13213133) is 2-nitro-N-phenylbenzenecarboximidoyl chloride.
What is the SMILES notation for 2-nitro-N-phenylbenzenecarboximidoyl chloride?
The canonical SMILES for 2-nitro-N-phenylbenzenecarboximidoyl chloride is O=[N+]([O-])c1ccccc1/C(Cl)=N/c1ccccc1.
What is the InChIKey of 2-nitro-N-phenylbenzenecarboximidoyl chloride?
The InChIKey is CYDYEUKLYFMUGJ-SQFISAMPSA-N. The full InChI is InChI=1S/C13H9ClN2O2/c14-13(15-10-6-2-1-3-7-10)11-8-4-5-9-12(11)16(17)18/h1-9H/b15-13-.
What are the key properties of 2-nitro-N-phenylbenzenecarboximidoyl chloride?
2-nitro-N-phenylbenzenecarboximidoyl chloride has a molecular weight of 260.68 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-N-phenylbenzenecarboximidoyl chloride is sourced from PubChem (CID 13213133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).