About imidazol-1-yl 4-piperidin-1-ylbutanoate
imidazol-1-yl 4-piperidin-1-ylbutanoate (PubChem CID 174984921) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is imidazol-1-yl 4-piperidin-1-ylbutanoate.
Molecular Properties
| Compound Name | imidazol-1-yl 4-piperidin-1-ylbutanoate |
| PubChem CID | 174984921 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | imidazol-1-yl 4-piperidin-1-ylbutanoate |
| SMILES | O=C(CCCN1CCCCC1)On1ccnc1 |
| InChI | InChI=1S/C12H19N3O2/c16-12(17-15-10-6-13-11-15)5-4-9-14-7-2-1-3-8-14/h6,10-11H,1-5,7-9H2 |
| InChIKey | USMDSACRKQOBSV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazol-1-yl 4-piperidin-1-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazol-1-yl 4-piperidin-1-ylbutanoate?
The IUPAC name of imidazol-1-yl 4-piperidin-1-ylbutanoate (CID 174984921) is imidazol-1-yl 4-piperidin-1-ylbutanoate.
What is the SMILES notation for imidazol-1-yl 4-piperidin-1-ylbutanoate?
The canonical SMILES for imidazol-1-yl 4-piperidin-1-ylbutanoate is O=C(CCCN1CCCCC1)On1ccnc1.
What is the InChIKey of imidazol-1-yl 4-piperidin-1-ylbutanoate?
The InChIKey is USMDSACRKQOBSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c16-12(17-15-10-6-13-11-15)5-4-9-14-7-2-1-3-8-14/h6,10-11H,1-5,7-9H2.
What are the key properties of imidazol-1-yl 4-piperidin-1-ylbutanoate?
imidazol-1-yl 4-piperidin-1-ylbutanoate has a molecular weight of 237.30 g/mol, XLogP of 1.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazol-1-yl 4-piperidin-1-ylbutanoate is sourced from PubChem (CID 174984921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).