C33H32N2O2 — CID 174985084
1-amino-1-(2-methoxy-5-phenyl-3-pyridinyl)-3-methyl-2-naphthalen-1-yl-1-phenylbutan-2-ol (PubChem CID 174985084) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1-amino-1-(2-methoxy-5-phenyl-3-pyridinyl)-3-methyl-2-naphthalen-1-yl-1-phenylbutan-2-ol.
| Compound Name | 1-amino-1-(2-methoxy-5-phenyl-3-pyridinyl)-3-methyl-2-naphthalen-1-yl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 174985084 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1-amino-1-(2-methoxy-5-phenyl-3-pyridinyl)-3-methyl-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| SMILES | COc1ncc(-c2ccccc2)cc1C(N)(c1ccccc1)C(O)(c1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C33H32N2O2/c1-23(2)33(36,29-20-12-16-25-15-10-11-19-28(25)29)32(34,27-17-8-5-9-18-27)30-21-26(22-35-31(30)37-3)24-13-6-4-7-14-24/h4-23,36H,34H2,1-3H3 |
| InChIKey | JUOXLNPMYCWIQU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |