C16H12N2O6S — CID 174985486
(4,5-dimethyl-1,3-thiazol-2-yl)methyl 6-nitro-2-oxochromene-3-carboxylate (PubChem CID 174985486) has the molecular formula C16H12N2O6S and a molecular weight of 360.35 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-thiazol-2-yl)methyl 6-nitro-2-oxochromene-3-carboxylate.
| Compound Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl 6-nitro-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 174985486 |
| Molecular Formula | C16H12N2O6S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl 6-nitro-2-oxochromene-3-carboxylate |
| SMILES | Cc1nc(COC(=O)c2cc3cc([N+](=O)[O-])ccc3oc2=O)sc1C |
| InChI | InChI=1S/C16H12N2O6S/c1-8-9(2)25-14(17-8)7-23-15(19)12-6-10-5-11(18(21)22)3-4-13(10)24-16(12)20/h3-6H,7H2,1-2H3 |
| InChIKey | ZFMPIALEBQKXNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|