C17H29NO3 — CID 174985662
(2E,4E)-4-[3-(tert-butylamino)-3-oxopropyl]deca-2,4-dienoic acid (PubChem CID 174985662) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (2E,4E)-4-[3-(tert-butylamino)-3-oxopropyl]deca-2,4-dienoic acid.
| Compound Name | (2E,4E)-4-[3-(tert-butylamino)-3-oxopropyl]deca-2,4-dienoic acid |
|---|---|
| PubChem CID | 174985662 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (2E,4E)-4-[3-(tert-butylamino)-3-oxopropyl]deca-2,4-dienoic acid |
| SMILES | CCCCC/C=C(/C=C/C(=O)O)CCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H29NO3/c1-5-6-7-8-9-14(11-13-16(20)21)10-12-15(19)18-17(2,3)4/h9,11,13H,5-8,10,12H2,1-4H3,(H,18,19)(H,20,21)/b13-11+,14-9+ |
| InChIKey | FPZDWWYLEBVWIA-AOAVBJDHSA-N |
| XLogP | 3.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|