C19H25NO3 — CID 174987194
(2E,4E)-4-[2-(benzylamino)-2-oxoethyl]deca-2,4-dienoic acid (PubChem CID 174987194) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2E,4E)-4-[2-(benzylamino)-2-oxoethyl]deca-2,4-dienoic acid.
| Compound Name | (2E,4E)-4-[2-(benzylamino)-2-oxoethyl]deca-2,4-dienoic acid |
|---|---|
| PubChem CID | 174987194 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2E,4E)-4-[2-(benzylamino)-2-oxoethyl]deca-2,4-dienoic acid |
| SMILES | CCCCC/C=C(/C=C/C(=O)O)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c1-2-3-4-6-9-16(12-13-19(22)23)14-18(21)20-15-17-10-7-5-8-11-17/h5,7-13H,2-4,6,14-15H2,1H3,(H,20,21)(H,22,23)/b13-12+,16-9- |
| InChIKey | COELWFRNSONKKH-AJUTYLIOSA-N |
| XLogP | 3.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|