4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid

C17H19N5O3 — CID 174986882

IUPAC4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid
SMILESCc1cc(-c2ccc(N)c(C)c2)ccc1N.N#CO.N=C=O.N=C=O
InChIInChI=1S/C14H16N2.3CHNO/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;3*2-1-3/h3-8H,15-16H2,1-2H3;3H;2*2H
InChIKeyRZMKWPKWPVCXFF-UHFFFAOYSA-N
MW341.37 g/mol
LogP2.78
Rot. Bonds1

About 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid

4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid (PubChem CID 174986882) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid.

Molecular Properties

Compound Name4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid
PubChem CID174986882
Molecular FormulaC17H19N5O3
Molecular Weight341.37 g/mol
Exact Mass341.15
IUPAC Name4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid
SMILESCc1cc(-c2ccc(N)c(C)c2)ccc1N.N#CO.N=C=O.N=C=O
InChIInChI=1S/C14H16N2.3CHNO/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;3*2-1-3/h3-8H,15-16H2,1-2H3;3H;2*2H
InChIKeyRZMKWPKWPVCXFF-UHFFFAOYSA-N
XLogP2.78
TPSA177.90 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds1
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.37
LogP ≤ 52.78
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid?
The IUPAC name of 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid (CID 174986882) is 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid.
What is the SMILES notation for 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid?
The canonical SMILES for 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid is Cc1cc(-c2ccc(N)c(C)c2)ccc1N.N#CO.N=C=O.N=C=O.
What is the InChIKey of 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid?
The InChIKey is RZMKWPKWPVCXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.3CHNO/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;3*2-1-3/h3-8H,15-16H2,1-2H3;3H;2*2H.
What are the key properties of 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid?
4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid has a molecular weight of 341.37 g/mol, XLogP of 2.78, 1 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methylphenyl)-2-methylaniline;cyanic acid;isocyanic acid is sourced from PubChem (CID 174986882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).