C15H16FN3O4S — CID 174990227
[3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl] carbamate (PubChem CID 174990227) has the molecular formula C15H16FN3O4S and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl] carbamate.
| Compound Name | [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl] carbamate |
|---|---|
| PubChem CID | 174990227 |
| Molecular Formula | C15H16FN3O4S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl] carbamate |
| SMILES | CS(=O)(=O)c1cccc(-c2cnn(CC(F)=CCOC(N)=O)c2)c1 |
| InChI | InChI=1S/C15H16FN3O4S/c1-24(21,22)14-4-2-3-11(7-14)12-8-18-19(9-12)10-13(16)5-6-23-15(17)20/h2-5,7-9H,6,10H2,1H3,(H2,17,20) |
| InChIKey | GTUBGLGROPFMCQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |