C17H28N3O10PS — CID 174993031
[3-[[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]oxy-hydroxyphosphoryl]oxy-2-acetyloxypropyl] acetate (PubChem CID 174993031) has the molecular formula C17H28N3O10PS and a molecular weight of 497.46 g/mol. Its IUPAC name is [3-[[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]oxy-hydroxyphosphoryl]oxy-2-acetyloxypropyl] acetate.
| Compound Name | [3-[[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]oxy-hydroxyphosphoryl]oxy-2-acetyloxypropyl] acetate |
|---|---|
| PubChem CID | 174993031 |
| Molecular Formula | C17H28N3O10PS |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [3-[[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]oxy-hydroxyphosphoryl]oxy-2-acetyloxypropyl] acetate |
| SMILES | CC(=O)OCC(COP(=O)(O)ONC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)OC(C)=O |
| InChI | InChI=1S/C17H28N3O10PS/c1-10(21)27-7-12(29-11(2)22)8-28-31(25,26)30-20-15(23)6-4-3-5-14-16-13(9-32-14)18-17(24)19-16/h12-14,16H,3-9H2,1-2H3,(H,20,23)(H,25,26)(H2,18,19,24)/t12?,13-,14?,16-/m0/s1 |
| InChIKey | WNBKYYZFBCJXJL-HTHKGWQXSA-N |
| XLogP | 0.37 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|