C13H10IN3O2S — CID 174993297
2-(5-iodo-3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 174993297) has the molecular formula C13H10IN3O2S and a molecular weight of 399.21 g/mol. Its IUPAC name is 2-(5-iodo-3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(5-iodo-3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 174993297 |
| Molecular Formula | C13H10IN3O2S |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 2-(5-iodo-3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1Cc2ccc(I)cc2C1=O)Nc1nccs1 |
| InChI | InChI=1S/C13H10IN3O2S/c14-9-2-1-8-6-17(12(19)10(8)5-9)7-11(18)16-13-15-3-4-20-13/h1-5H,6-7H2,(H,15,16,18) |
| InChIKey | MLDAWSSSHJILLG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|