C8H11F3N4O — CID 174994560
4-methyl-6-(2,2,2-trifluoroethoxy)pyridine-2,3,5-triamine (PubChem CID 174994560) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 4-methyl-6-(2,2,2-trifluoroethoxy)pyridine-2,3,5-triamine.
| Compound Name | 4-methyl-6-(2,2,2-trifluoroethoxy)pyridine-2,3,5-triamine |
|---|---|
| PubChem CID | 174994560 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4-methyl-6-(2,2,2-trifluoroethoxy)pyridine-2,3,5-triamine |
| SMILES | Cc1c(N)c(N)nc(OCC(F)(F)F)c1N |
| InChI | InChI=1S/C8H11F3N4O/c1-3-4(12)6(14)15-7(5(3)13)16-2-8(9,10)11/h2,12-13H2,1H3,(H2,14,15) |
| InChIKey | MEUYRIPLELPNOC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |