About sodium phenylmethoxyarsinate
sodium phenylmethoxyarsinate (PubChem CID 174995318) has the molecular formula C7H8AsNaO3
and a molecular weight of 238.05 g/mol. Its IUPAC name is sodium phenylmethoxyarsinate.
Molecular Properties
| Compound Name | sodium phenylmethoxyarsinate |
| PubChem CID | 174995318 |
| Molecular Formula | C7H8AsNaO3 |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | sodium phenylmethoxyarsinate |
| SMILES | O=[AsH]([O-])OCc1ccccc1.[Na+] |
| InChI | InChI=1S/C7H9AsO3.Na/c9-8(10)11-6-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | DNSWWSXHPHDKQO-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium phenylmethoxyarsinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium phenylmethoxyarsinate?
The IUPAC name of sodium phenylmethoxyarsinate (CID 174995318) is sodium phenylmethoxyarsinate.
What is the SMILES notation for sodium phenylmethoxyarsinate?
The canonical SMILES for sodium phenylmethoxyarsinate is O=[AsH]([O-])OCc1ccccc1.[Na+].
What is the InChIKey of sodium phenylmethoxyarsinate?
The InChIKey is DNSWWSXHPHDKQO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9AsO3.Na/c9-8(10)11-6-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10);/q;+1/p-1.
What are the key properties of sodium phenylmethoxyarsinate?
sodium phenylmethoxyarsinate has a molecular weight of 238.05 g/mol, XLogP of -3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium phenylmethoxyarsinate is sourced from PubChem (CID 174995318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).