About amino prop-2-enoate;sulfanylidenecopper
amino prop-2-enoate;sulfanylidenecopper (PubChem CID 174997703) has the molecular formula C3H5CuNO2S
and a molecular weight of 182.69 g/mol. Its IUPAC name is amino prop-2-enoate;sulfanylidenecopper.
Molecular Properties
| Compound Name | amino prop-2-enoate;sulfanylidenecopper |
| PubChem CID | 174997703 |
| Molecular Formula | C3H5CuNO2S |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 181.93 |
| IUPAC Name | amino prop-2-enoate;sulfanylidenecopper |
| SMILES | C=CC(=O)ON.S=[Cu] |
| InChI | InChI=1S/C3H5NO2.Cu.S/c1-2-3(5)6-4;;/h2H,1,4H2;; |
| InChIKey | LAMPLFCBLWHTAW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino prop-2-enoate;sulfanylidenecopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino prop-2-enoate;sulfanylidenecopper?
The IUPAC name of amino prop-2-enoate;sulfanylidenecopper (CID 174997703) is amino prop-2-enoate;sulfanylidenecopper.
What is the SMILES notation for amino prop-2-enoate;sulfanylidenecopper?
The canonical SMILES for amino prop-2-enoate;sulfanylidenecopper is C=CC(=O)ON.S=[Cu].
What is the InChIKey of amino prop-2-enoate;sulfanylidenecopper?
The InChIKey is LAMPLFCBLWHTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.Cu.S/c1-2-3(5)6-4;;/h2H,1,4H2;;.
What are the key properties of amino prop-2-enoate;sulfanylidenecopper?
amino prop-2-enoate;sulfanylidenecopper has a molecular weight of 182.69 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino prop-2-enoate;sulfanylidenecopper is sourced from PubChem (CID 174997703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).