About trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione
trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione (PubChem CID 174998095) has the molecular formula C14H26S7
and a molecular weight of 418.83 g/mol. Its IUPAC name is trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione.
Molecular Properties
| Compound Name | trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione |
| PubChem CID | 174998095 |
| Molecular Formula | C14H26S7 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione |
| SMILES | CCCCCCCCCCCC1SC1=S.S=C(S)SSS |
| InChI | InChI=1S/C13H24S2.CH2S5/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15-12;2-1(3)5-6-4/h12H,2-11H2,1H3;4H,(H,2,3) |
| InChIKey | AGANPAABLADOLX-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione?
The IUPAC name of trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione (CID 174998095) is trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione.
What is the SMILES notation for trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione?
The canonical SMILES for trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione is CCCCCCCCCCCC1SC1=S.S=C(S)SSS.
What is the InChIKey of trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione?
The InChIKey is AGANPAABLADOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24S2.CH2S5/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15-12;2-1(3)5-6-4/h12H,2-11H2,1H3;4H,(H,2,3).
What are the key properties of trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione?
trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione has a molecular weight of 418.83 g/mol, XLogP of 7.78, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisulfanylmethanedithioic acid;3-undecylthiirane-2-thione is sourced from PubChem (CID 174998095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).