About ethenyl prop-2-enoxy hydrogen phosphite
ethenyl prop-2-enoxy hydrogen phosphite (PubChem CID 175000913) has the molecular formula C5H9O4P
and a molecular weight of 164.10 g/mol. Its IUPAC name is ethenyl prop-2-enoxy hydrogen phosphite.
Molecular Properties
| Compound Name | ethenyl prop-2-enoxy hydrogen phosphite |
| PubChem CID | 175000913 |
| Molecular Formula | C5H9O4P |
| Molecular Weight | 164.10 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | ethenyl prop-2-enoxy hydrogen phosphite |
| SMILES | C=CCOOP(O)OC=C |
| InChI | InChI=1S/C5H9O4P/c1-3-5-7-9-10(6)8-4-2/h3-4,6H,1-2,5H2 |
| InChIKey | UMVVQCMXVRMUJY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethenyl prop-2-enoxy hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl prop-2-enoxy hydrogen phosphite?
The IUPAC name of ethenyl prop-2-enoxy hydrogen phosphite (CID 175000913) is ethenyl prop-2-enoxy hydrogen phosphite.
What is the SMILES notation for ethenyl prop-2-enoxy hydrogen phosphite?
The canonical SMILES for ethenyl prop-2-enoxy hydrogen phosphite is C=CCOOP(O)OC=C.
What is the InChIKey of ethenyl prop-2-enoxy hydrogen phosphite?
The InChIKey is UMVVQCMXVRMUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O4P/c1-3-5-7-9-10(6)8-4-2/h3-4,6H,1-2,5H2.
What are the key properties of ethenyl prop-2-enoxy hydrogen phosphite?
ethenyl prop-2-enoxy hydrogen phosphite has a molecular weight of 164.10 g/mol, XLogP of 1.50, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl prop-2-enoxy hydrogen phosphite is sourced from PubChem (CID 175000913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).