sodium;hydride;prop-2-enyl propyl hydrogen phosphite

C6H14NaO3P — CID 173408314

IUPACsodium;hydride;prop-2-enyl propyl hydrogen phosphite
SMILESC=CCOP(O)OCCC.[H-].[Na+]
InChIInChI=1S/C6H13O3P.Na.H/c1-3-5-8-10(7)9-6-4-2;;/h3,7H,1,4-6H2,2H3;;/q;+1;-1
InChIKeyCWOOFGZATRUMFP-UHFFFAOYSA-N
MW188.14 g/mol
LogP-1.05
Rot. Bonds6

About sodium;hydride;prop-2-enyl propyl hydrogen phosphite

sodium;hydride;prop-2-enyl propyl hydrogen phosphite (PubChem CID 173408314) has the molecular formula C6H14NaO3P and a molecular weight of 188.14 g/mol. Its IUPAC name is sodium;hydride;prop-2-enyl propyl hydrogen phosphite.

Molecular Properties

Compound Namesodium;hydride;prop-2-enyl propyl hydrogen phosphite
PubChem CID173408314
Molecular FormulaC6H14NaO3P
Molecular Weight188.14 g/mol
Exact Mass188.06
IUPAC Namesodium;hydride;prop-2-enyl propyl hydrogen phosphite
SMILESC=CCOP(O)OCCC.[H-].[Na+]
InChIInChI=1S/C6H13O3P.Na.H/c1-3-5-8-10(7)9-6-4-2;;/h3,7H,1,4-6H2,2H3;;/q;+1;-1
InChIKeyCWOOFGZATRUMFP-UHFFFAOYSA-N
XLogP-1.05
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.14
LogP ≤ 5-1.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze sodium;hydride;prop-2-enyl propyl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;prop-2-enyl propyl hydrogen phosphite?
The IUPAC name of sodium;hydride;prop-2-enyl propyl hydrogen phosphite (CID 173408314) is sodium;hydride;prop-2-enyl propyl hydrogen phosphite.
What is the SMILES notation for sodium;hydride;prop-2-enyl propyl hydrogen phosphite?
The canonical SMILES for sodium;hydride;prop-2-enyl propyl hydrogen phosphite is C=CCOP(O)OCCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;prop-2-enyl propyl hydrogen phosphite?
The InChIKey is CWOOFGZATRUMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O3P.Na.H/c1-3-5-8-10(7)9-6-4-2;;/h3,7H,1,4-6H2,2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;prop-2-enyl propyl hydrogen phosphite?
sodium;hydride;prop-2-enyl propyl hydrogen phosphite has a molecular weight of 188.14 g/mol, XLogP of -1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;prop-2-enyl propyl hydrogen phosphite is sourced from PubChem (CID 173408314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).