About sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite
sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite (PubChem CID 173408403) has the molecular formula C6H14NaO5P
and a molecular weight of 220.14 g/mol. Its IUPAC name is sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite |
| PubChem CID | 173408403 |
| Molecular Formula | C6H14NaO5P |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite |
| SMILES | C=CCOC(O)(CC)OP(O)O.[H-].[Na+] |
| InChI | InChI=1S/C6H13O5P.Na.H/c1-3-5-10-6(7,4-2)11-12(8)9;;/h3,7-9H,1,4-5H2,2H3;;/q;+1;-1 |
| InChIKey | QOQLJMDGZQGTCB-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite?
The IUPAC name of sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite (CID 173408403) is sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite.
What is the SMILES notation for sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite?
The canonical SMILES for sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite is C=CCOC(O)(CC)OP(O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite?
The InChIKey is QOQLJMDGZQGTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O5P.Na.H/c1-3-5-10-6(7,4-2)11-12(8)9;;/h3,7-9H,1,4-5H2,2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite?
sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite has a molecular weight of 220.14 g/mol, XLogP of -2.41, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(1-hydroxy-1-prop-2-enoxypropyl) dihydrogen phosphite is sourced from PubChem (CID 173408403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).